4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 95%
cas: 2186640-06-0 — see every product listed under this CAS number, including other names
4-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 95% (CAS 2186640-06-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1273931-50mg |
| cas | 2186640-06-0 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1065.69 Pln | |
| Ambeed | 100mg | 1610.81 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 7696.19 Pln | |
| Ambeed | 5g | 23260.06 Pln | |
| BLDpharm | 50mg | 1141.84 Pln | |
| BLDpharm | 100mg | 1730.53 Pln | |
| BLDpharm | 250mg | 3407.71 Pln | |
| BLDpharm | 1g | 8289.33 Pln | |
| BLDpharm | 5g | 25072.31 Pln | |
| Chemat | 50mg | 1067.60 Pln | |
| Chemat | 100mg | 1576.40 Pln | |
| Chemat | 250mg | 2406.80 Pln | |
| Chemat | 1g | 6122.00 Pln | |
| Chemat | 5g | 23402.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 2186640-06-0) is a chemical compound with the molecular formula C10H16BNO3 and a molecular weight of 209.05 g/mol. IUPAC name: 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: UWQYMGROHBJEED-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO3 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | 4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | UWQYMGROHBJEED-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CO2)C |
Computed by PubChem (NCBI)