cas: 10447-11-7 — see every product listed under this CAS number, including other names
4-Methylnaphthalene-1-sulfonyl chloride, 95% (CAS 10447-11-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233109-1G |
| cas | 10447-11-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 1924.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-methylnaphthalene-1-sulfonyl chloride (CAS 10447-11-7) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: 4-methylnaphthalene-1-sulfonyl chloride. InChIKey: WLEBLSWMOQCGTE-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | 4-methylnaphthalene-1-sulfonyl chloride |
| InChIKey | WLEBLSWMOQCGTE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)S(=O)(=O)Cl |
Computed by PubChem (NCBI)