CAS 1415968-74-9 appears in our catalog under these names: Methyl 6–chloro–3–methylbenzo(b)thiophene–2–carboxylate, Methyl 6-chloro-3-methylbenzo[b]thiophene-2-carboxylate 97%, 6-Chloro-3-methyl benzothiophene-2-carboxylic acid methyl ester, 98%, 98%, METHYL 6-CHLORO-3-METHYLBENZO[B]THIOPHENE-2-CARBOXYLATE, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g.
Methyl 6-chloro-3-methyl-1-benzothiophene-2-carboxylate (CAS 1415968-74-9) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: methyl 6-chloro-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: GIWWBGTXBMMEJL-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | methyl 6-chloro-3-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | GIWWBGTXBMMEJL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=CC(=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)