Products 1415968-73-8

CAS 1415968-73-8 is the registry number for 4-Chloro-3-methyl benzothiophene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate (CAS 1415968-73-8) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: methyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: KESJJOKEOXAERJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClO2S
Molecular weight240.71 g/mol
IUPAC namemethyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate
InChIKeyKESJJOKEOXAERJ-UHFFFAOYSA-N
SMILESCC1=C(SC2=C1C(=CC=C2)Cl)C(=O)OC

Computed by PubChem (NCBI)