CAS 1415968-73-8 is the registry number for 4-Chloro-3-methyl benzothiophene-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate (CAS 1415968-73-8) is a chemical compound with the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. IUPAC name: methyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate. InChIKey: KESJJOKEOXAERJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2S |
|---|---|
| Molecular weight | 240.71 g/mol |
| IUPAC name | methyl 4-chloro-3-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | KESJJOKEOXAERJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=CC=C2)Cl)C(=O)OC |
Computed by PubChem (NCBI)