cas: 51317-66-9 — see every product listed under this CAS number, including other names
4-Morpholinophenyl isothiocyanate, 97% (CAS 51317-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC17407CB |
| cas | 51317-66-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 419.99 Pln | |
| Thermo Scientific | 1g | 1130.16 Pln | |
| Thermo Scientific | 5g | 3446.47 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(4-isothiocyanatophenyl)morpholine (CAS 51317-66-9) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 4-(4-isothiocyanatophenyl)morpholine. InChIKey: AXUXRZZYZBZQAR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 4-(4-isothiocyanatophenyl)morpholine |
| InChIKey | AXUXRZZYZBZQAR-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)