CAS 32262-28-5 is the registry number for 3-(2,6-Dimethylphenyl)-2-mercapto-3,5-dihydro-4h-imidazol-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-(2,6-dimethylphenyl)-2-sulfanylideneimidazolidin-4-one (CAS 32262-28-5) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 3-(2,6-dimethylphenyl)-2-sulfanylideneimidazolidin-4-one. InChIKey: ZDOMPUIOXIQMSG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 3-(2,6-dimethylphenyl)-2-sulfanylideneimidazolidin-4-one |
| InChIKey | ZDOMPUIOXIQMSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N2C(=O)CNC2=S |
Computed by PubChem (NCBI)