CAS 36017-41-1 is the registry number for 1-Benzyl-4-methyl-2-sulfanyl-4,5-dihydro-1h-imidazol-5-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-benzyl-5-methyl-2-sulfanylideneimidazolidin-4-one (CAS 36017-41-1) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 3-benzyl-5-methyl-2-sulfanylideneimidazolidin-4-one. InChIKey: CGSCAUMDHKDVJR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 3-benzyl-5-methyl-2-sulfanylideneimidazolidin-4-one |
| InChIKey | CGSCAUMDHKDVJR-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C(=S)N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)