cas: 865450-09-5 — see every product listed under this CAS number, including other names
4-N-Boc-Amino-3-fluorobenzaldehyde, 98% (CAS 865450-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040853-100MG |
| cas | 865450-09-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 409.25 Pln | |
| Fluorochem | 250mg | 627.92 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 4183.96 Pln | |
| Fluorochem | 10g | 8229.41 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-fluoro-4-formylphenyl)carbamate (CAS 865450-09-5) is a chemical compound with the molecular formula C12H14FNO3 and a molecular weight of 239.24 g/mol. IUPAC name: tert-butyl N-(2-fluoro-4-formylphenyl)carbamate. InChIKey: QQWNYOVSVMTGAY-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO3 |
|---|---|
| Molecular weight | 239.24 g/mol |
| IUPAC name | tert-butyl N-(2-fluoro-4-formylphenyl)carbamate |
| InChIKey | QQWNYOVSVMTGAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C=O)F |
Computed by PubChem (NCBI)