CAS 2766202-65-5 is the registry number for Benzyl (2S,3S,4S)-4-fluoro-3-hydroxypyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,3S,4S)-4-fluoro-3-hydroxypyrrolidine-2-carboxylate (CAS 2766202-65-5) is a chemical compound with the molecular formula C12H14FNO3 and a molecular weight of 239.24 g/mol. IUPAC name: benzyl (2S,3S,4S)-4-fluoro-3-hydroxypyrrolidine-2-carboxylate. InChIKey: WLRVJBIOFAMRAM-GARJFASQSA-N.
| Molecular formula | C12H14FNO3 |
|---|---|
| Molecular weight | 239.24 g/mol |
| IUPAC name | benzyl (2S,3S,4S)-4-fluoro-3-hydroxypyrrolidine-2-carboxylate |
| InChIKey | WLRVJBIOFAMRAM-GARJFASQSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](N1)C(=O)OCC2=CC=CC=C2)O)F |
Computed by PubChem (NCBI)