CAS 2270915-02-9 is the registry number for Methyl (2e)-2-(aminomethyl)-3-(4-fluoro-3-methoxyphenyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl (E)-2-(aminomethyl)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoate (CAS 2270915-02-9) is a chemical compound with the molecular formula C12H14FNO3 and a molecular weight of 239.24 g/mol. IUPAC name: methyl (E)-2-(aminomethyl)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoate. InChIKey: IQFMIZKZAUFQIU-WEVVVXLNSA-N.
| Molecular formula | C12H14FNO3 |
|---|---|
| Molecular weight | 239.24 g/mol |
| IUPAC name | methyl (E)-2-(aminomethyl)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoate |
| InChIKey | IQFMIZKZAUFQIU-WEVVVXLNSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C(\CN)/C(=O)OC)F |
Computed by PubChem (NCBI)