cas: 221352-86-9 — see every product listed under this CAS number, including other names
4-N-Fmoc-Aminopiperidine hydrochloride, 98%, 98% (CAS 221352-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LTV-100mg |
| cas | 221352-86-9 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1504.40 Pln | |
| Chemat | 10g | 2402.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride (CAS 221352-86-9) is a chemical compound with the molecular formula C20H23ClN2O2 and a molecular weight of 358.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride. InChIKey: MOAIDLUWFCXIJA-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN2O2 |
|---|---|
| Molecular weight | 358.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride |
| InChIKey | MOAIDLUWFCXIJA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24.Cl |
Computed by PubChem (NCBI)