cas: 221352-86-9 — see every product listed under this CAS number, including other names
4-N-Fmoc-amino-piperidine hydrochloride, 95% (CAS 221352-86-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | SS-1238-1g |
| cas | 221352-86-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1820.21 Pln | |
| Fluorochem | 10g | 3580.01 Pln | |
| Fluorochem | 25g | 5058.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride (CAS 221352-86-9) is a chemical compound with the molecular formula C20H23ClN2O2 and a molecular weight of 358.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride. InChIKey: MOAIDLUWFCXIJA-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN2O2 |
|---|---|
| Molecular weight | 358.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-piperidin-4-ylcarbamate;hydrochloride |
| InChIKey | MOAIDLUWFCXIJA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24.Cl |
Computed by PubChem (NCBI)