4-Nitro-1H-pyrrole-2-carbonitrile, 95%
cas: 59027-78-0 — see every product listed under this CAS number, including other names
4-Nitro-1H-pyrrole-2-carbonitrile, 95% (CAS 59027-78-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A840139-250mg |
| cas | 59027-78-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1939.00 Pln | |
| Ambeed | 5g | 5359.94 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1941.20 Pln | |
| Chemat | 5g | 5387.60 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 2085.96 Pln | |
| BLDpharm | 5g | 5773.55 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-nitro-1H-pyrrole-2-carbonitrile (CAS 59027-78-0) is a chemical compound with the molecular formula C5H3N3O2 and a molecular weight of 137.10 g/mol. IUPAC name: 4-nitro-1H-pyrrole-2-carbonitrile. InChIKey: MREAXPUBJGTJCP-UHFFFAOYSA-N.
| Molecular formula | C5H3N3O2 |
|---|---|
| Molecular weight | 137.10 g/mol |
| IUPAC name | 4-nitro-1H-pyrrole-2-carbonitrile |
| InChIKey | MREAXPUBJGTJCP-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C1[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)