Products 1045733-76-3

CAS 1045733-76-3 is the registry number for 4-Cyano-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-cyano-1H-pyrazole-5-carboxylic acid (CAS 1045733-76-3) is a chemical compound with the molecular formula C5H3N3O2 and a molecular weight of 137.10 g/mol. IUPAC name: 4-cyano-1H-pyrazole-5-carboxylic acid. InChIKey: AAXCTCRAEHZVHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3N3O2
Molecular weight137.10 g/mol
IUPAC name4-cyano-1H-pyrazole-5-carboxylic acid
InChIKeyAAXCTCRAEHZVHJ-UHFFFAOYSA-N
SMILESC1=NNC(=C1C#N)C(=O)O

Computed by PubChem (NCBI)