Products 1026882-55-2

CAS 1026882-55-2 is the registry number for 4-Cyano-1H-imidazole-2-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

5-cyano-1H-imidazole-2-carboxylic acid (CAS 1026882-55-2) is a chemical compound with the molecular formula C5H3N3O2 and a molecular weight of 137.10 g/mol. IUPAC name: 5-cyano-1H-imidazole-2-carboxylic acid. InChIKey: XTDRPNJABDWQFI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3N3O2
Molecular weight137.10 g/mol
IUPAC name5-cyano-1H-imidazole-2-carboxylic acid
InChIKeyXTDRPNJABDWQFI-UHFFFAOYSA-N
SMILESC1=C(NC(=N1)C(=O)O)C#N

Computed by PubChem (NCBI)