CAS 34701-14-9 appears in our catalog under these names: 4-nitro-2,3-dihydro-1H-indene, 95%, 4-Nitroindan 95%, 4-Nitro-2,3-dihydro-1H-indene, 95%, 95%, 4-Nitro-2,3-dihydro-1H-indene, ≥97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
4-nitro-2,3-dihydro-1H-indene (CAS 34701-14-9) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 4-nitro-2,3-dihydro-1H-indene. InChIKey: ZQABKMBXKCJTPM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 4-nitro-2,3-dihydro-1H-indene |
| InChIKey | ZQABKMBXKCJTPM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)