cas: 200295-57-4 — see every product listed under this CAS number, including other names
4-Nitrobenzene-1,3-diamine sulfate, 98%+,RG, 98%+,RG (CAS 200295-57-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CNL-5g |
| cas | 200295-57-4 |
| size | 5g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 362.00 Pln |
| purity | 98%+,RG |
|---|---|
| delivery time | 3 weeks |
4-nitrobenzene-1,3-diamine;sulfuric acid (CAS 200295-57-4) is a chemical compound with the molecular formula C6H9N3O6S and a molecular weight of 251.22 g/mol. IUPAC name: 4-nitrobenzene-1,3-diamine;sulfuric acid. InChIKey: STFQGUXLVLJZDB-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O6S |
|---|---|
| Molecular weight | 251.22 g/mol |
| IUPAC name | 4-nitrobenzene-1,3-diamine;sulfuric acid |
| InChIKey | STFQGUXLVLJZDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)[N+](=O)[O-].OS(=O)(=O)O |
Computed by PubChem (NCBI)