Products 200295-57-4
CAS 200295-57-4 appears in our catalog under these names: 4-Nitrobenzene-1,3-diamine sulfate, 98%, 4-Nitrobenzene-1,3-diamine sulfate, 97%, 4-Nitrobenzene-1,3-diamine sulfate, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
4-nitrobenzene-1,3-diamine;sulfuric acid (CAS 200295-57-4) is a chemical compound with the molecular formula C6H9N3O6S and a molecular weight of 251.22 g/mol. IUPAC name: 4-nitrobenzene-1,3-diamine;sulfuric acid. InChIKey: STFQGUXLVLJZDB-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O6S |
|---|---|
| Molecular weight | 251.22 g/mol |
| IUPAC name | 4-nitrobenzene-1,3-diamine;sulfuric acid |
| InChIKey | STFQGUXLVLJZDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)[N+](=O)[O-].OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Nitro-m-phenylenediamine sulfate, 4-Nitrobenzene-1,3-diamine sulfate, p-Nitro-m-phenylenediamine sulfate, 4-nitrobenzene-1,3-diamine;sulfuric acid, 1,3-Benzenediamine, 4-nitro-, sulfate, 4-Nitrobenzene-1,3-diaminesulfate, 4-Nitrobenzene-13-diamine sulfate, 4-nitrobenzene-1,3-diamine,sulfuric acid, Sulfuric acid--4-nitrobenzene-1,3-diamine (1/1)