Products 68239-83-8

CAS 68239-83-8 is the registry number for 2-Nitrobenzene-1,4-diamine sulfate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-nitrobenzene-1,4-diamine;sulfuric acid (CAS 68239-83-8) is a chemical compound with the molecular formula C6H9N3O6S and a molecular weight of 251.22 g/mol. IUPAC name: 2-nitrobenzene-1,4-diamine;sulfuric acid. InChIKey: XRALJHVEDJNLBL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O6S
Molecular weight251.22 g/mol
IUPAC name2-nitrobenzene-1,4-diamine;sulfuric acid
InChIKeyXRALJHVEDJNLBL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N)[N+](=O)[O-])N.OS(=O)(=O)O

Computed by PubChem (NCBI)