CAS 68239-83-8 is the registry number for 2-Nitrobenzene-1,4-diamine sulfate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitrobenzene-1,4-diamine;sulfuric acid (CAS 68239-83-8) is a chemical compound with the molecular formula C6H9N3O6S and a molecular weight of 251.22 g/mol. IUPAC name: 2-nitrobenzene-1,4-diamine;sulfuric acid. InChIKey: XRALJHVEDJNLBL-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O6S |
|---|---|
| Molecular weight | 251.22 g/mol |
| IUPAC name | 2-nitrobenzene-1,4-diamine;sulfuric acid |
| InChIKey | XRALJHVEDJNLBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])N.OS(=O)(=O)O |
Computed by PubChem (NCBI)