cas: 5339-26-4 — see every product listed under this CAS number, including other names
4-Nitrophenethyl bromide, 98% (CAS 5339-26-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 100g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 151620050 |
| cas | 5339-26-4 |
| size | 5g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 218.27 Pln | |
| Thermo Scientific (Acros) | 25g | 654.80 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 180.16 Pln | |
| Fluorochem | 500g | 664.37 Pln | |
| Fluorochem | 1kg | 1257.91 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
1-(2-bromoethyl)-4-nitrobenzene (CAS 5339-26-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 1-(2-bromoethyl)-4-nitrobenzene. InChIKey: NTURQZFFJDCTMZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-nitrobenzene |
| InChIKey | NTURQZFFJDCTMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)