CAS 824-78-2 appears in our catalog under these names: 4-Nitrophenol Sodium Salt (controlled substance), 4-Nitrophenol sodium, 4-Nitrophenol sodium 100 µg/mL in Acetonitrile. Offered by: Chemat Brand, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 250mg, 1ml, 1x250mg.
Sodium 4-nitrophenolate (CAS 824-78-2) is a chemical compound with the molecular formula C6H4NNaO3 and a molecular weight of 161.09 g/mol. IUPAC name: sodium 4-nitrophenolate. InChIKey: CURNJKLCYZZBNJ-UHFFFAOYSA-M.
| Molecular formula | C6H4NNaO3 |
|---|---|
| Molecular weight | 161.09 g/mol |
| IUPAC name | sodium 4-nitrophenolate |
| InChIKey | CURNJKLCYZZBNJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])[O-].[Na+] |
Computed by PubChem (NCBI)