4-Nitrophthalonitrile, 98%, 98%
cas: 31643-49-9 — see every product listed under this CAS number, including other names
4-Nitrophthalonitrile, 98%, 98% (CAS 31643-49-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145AZ-5g |
| cas | 31643-49-9 |
| size | 5g |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 432.00 Pln | |
| Chemat | 1kg | 688.40 Pln | |
| Chemat | 5kg | 3196.80 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitrobenzene-1,2-dicarbonitrile (CAS 31643-49-9) is a chemical compound with the molecular formula C8H3N3O2 and a molecular weight of 173.13 g/mol. IUPAC name: 4-nitrobenzene-1,2-dicarbonitrile. InChIKey: NTZMSBAAHBICLE-UHFFFAOYSA-N.
| Molecular formula | C8H3N3O2 |
|---|---|
| Molecular weight | 173.13 g/mol |
| IUPAC name | 4-nitrobenzene-1,2-dicarbonitrile |
| InChIKey | NTZMSBAAHBICLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C#N)C#N |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophthalonitrile, 4-nitrobenzene-1,2-dicarbonitrile, 5-Nitrobenzene-1,2-dicarbonitrile, 4-Nitro-1,2-benzenedicarbonitrile, 3,4-Dicyanonitrobenzene, 1,2-Benzenedicarbonitrile, 4-nitro-, Phthalonitrile, 4-nitro-, 5-Nitro-1,2-benzenedicarbonitrile, 4-Nitro-phthalonitrile, 1,2-Dicyano-4-nitrobenzene