cas: 13505-02-7 — see every product listed under this CAS number, including other names
4-Nitropyridin-3-amine, 97% (CAS 13505-02-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A115689-250mg |
| cas | 13505-02-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1079.05 Pln | |
| AmBeed | 1g | 2582.86 Pln | |
| AmBeed | 5g | 7602.07 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-nitropyridin-3-amine (CAS 13505-02-7) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 4-nitropyridin-3-amine. InChIKey: SXIUYRNIWXQXEA-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 4-nitropyridin-3-amine |
| InChIKey | SXIUYRNIWXQXEA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)