cas: 170856-87-8 — see every product listed under this CAS number, including other names
4-PIPERAZINYL BENZENESULFONAMIDE, 98%, 98% (CAS 170856-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AM19-5g |
| cas | 170856-87-8 |
| size | 5g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 942.80 Pln | |
| Chemat | 10g | 1528.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-piperazin-1-ylbenzenesulfonamide (CAS 170856-87-8) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 4-piperazin-1-ylbenzenesulfonamide. InChIKey: UGGDHKASBRILQW-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzenesulfonamide |
| InChIKey | UGGDHKASBRILQW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)