CAS 69249-13-4 is the registry number for 4-(Piperazin-1-ylsulfonyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
4-piperazin-1-ylsulfonylaniline (CAS 69249-13-4) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 4-piperazin-1-ylsulfonylaniline. InChIKey: GFDCXCIQDDYTEL-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-piperazin-1-ylsulfonylaniline |
| InChIKey | GFDCXCIQDDYTEL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)