CAS 170856-87-8 appears in our catalog under these names: 4-PIPERAZINYL BENZENESULFONAMIDE, 98%, 98%, 4-(Piperazin-1-yl)benzenesulfonamide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g.
4-piperazin-1-ylbenzenesulfonamide (CAS 170856-87-8) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: 4-piperazin-1-ylbenzenesulfonamide. InChIKey: UGGDHKASBRILQW-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzenesulfonamide |
| InChIKey | UGGDHKASBRILQW-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)