cas: 106877-21-8 — see every product listed under this CAS number, including other names
4-Phenoxy-2-(trifluoromethyl)aniline (CAS 106877-21-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 10mg. Offered by: Biosynth, Chemat.
| brand | Biosynth |
|---|---|
| catalog number | GEA87721-10g |
| cas | 106877-21-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10g | price on request | |
| Biosynth | 5g | price on request | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1072.40 Pln | |
| Chemat | 5g | 4110.80 Pln | |
| Chemat | 10mg | 194.00 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
4-phenoxy-2-(trifluoromethyl)aniline (CAS 106877-21-8) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 4-phenoxy-2-(trifluoromethyl)aniline. InChIKey: CWKQMUBTZIPBLG-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 4-phenoxy-2-(trifluoromethyl)aniline |
| InChIKey | CWKQMUBTZIPBLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)