cas: 206556-00-5 — see every product listed under this CAS number, including other names
4-Phenyl-1,3-thiazole-5-carbaldehyde, 95%, 95% (CAS 206556-00-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CFPB-50mg |
| cas | 206556-00-5 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 371.60 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 2622.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-phenyl-1,3-thiazole-5-carbaldehyde (CAS 206556-00-5) is a chemical compound with the molecular formula C10H7NOS and a molecular weight of 189.24 g/mol. IUPAC name: 4-phenyl-1,3-thiazole-5-carbaldehyde. InChIKey: ZCFVPBKIUPRFQR-UHFFFAOYSA-N.
| Molecular formula | C10H7NOS |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 4-phenyl-1,3-thiazole-5-carbaldehyde |
| InChIKey | ZCFVPBKIUPRFQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC=N2)C=O |
Computed by PubChem (NCBI)