CAS 1201561-34-3 appears in our catalog under these names: 4–Phenyl–9H–carbazole, 4-Phenyl-9H-carbazole, >98.0%(GC), 4-Phenyl-9H-carbazole, 98%, 98%, 4-Phenyl-9H-carbazole. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
4-phenyl-9H-carbazole (CAS 1201561-34-3) is a chemical compound with the molecular formula C18H13N and a molecular weight of 243.3 g/mol. IUPAC name: 4-phenyl-9H-carbazole. InChIKey: MHYZYLQHHQNSPV-UHFFFAOYSA-N.
| Molecular formula | C18H13N |
|---|---|
| Molecular weight | 243.3 g/mol |
| IUPAC name | 4-phenyl-9H-carbazole |
| InChIKey | MHYZYLQHHQNSPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C4=CC=CC=C4NC3=CC=C2 |
Computed by PubChem (NCBI)