cas: 131-22-6 — see every product listed under this CAS number, including other names
4-Phenylazo-1-naphthylamine, 97%+(LC-MS),RG, 97%+(LC-MS),RG (CAS 131-22-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VAD-1g |
| cas | 131-22-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 25g | 1158.80 Pln |
| purity | 97%+(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
4-phenyldiazenylnaphthalen-1-amine (CAS 131-22-6) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-phenyldiazenylnaphthalen-1-amine. InChIKey: IICHURGZQPGTRD-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-phenyldiazenylnaphthalen-1-amine |
| InChIKey | IICHURGZQPGTRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C3=CC=CC=C32)N |
Computed by PubChem (NCBI)