CAS 706753-75-5 appears in our catalog under these names: Epinastine EP Impurity A (Dehydro Epinastine), Epinastine EP Impurity A, 9H-Dibenzo[c,f]imidazo[1,5-a]azepin-3-amine, 98%, Epinastine Impurity 1(Epinastine EP Impurity A Monomer), 9,13b-Dehydro Epinastine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,5mg.
2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine (CAS 706753-75-5) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine. InChIKey: HQGAYYUSWZSGDC-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaen-3-amine |
| InChIKey | HQGAYYUSWZSGDC-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=CN=C(N3C4=CC=CC=C41)N |
Computed by PubChem (NCBI)