CAS 1403483-72-6 appears in our catalog under these names: 1-Benzyl-2-methyl-1,3-benzodiazole-5-carbonitrile, 97%, 1-Benzyl-2-methyl-1,3-benzodiazole-5-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10000mg, 5000mg.
1-benzyl-2-methylbenzimidazole-5-carbonitrile (CAS 1403483-72-6) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 1-benzyl-2-methylbenzimidazole-5-carbonitrile. InChIKey: DJGSHZNASXSXGL-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-benzyl-2-methylbenzimidazole-5-carbonitrile |
| InChIKey | DJGSHZNASXSXGL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1CC3=CC=CC=C3)C=CC(=C2)C#N |
Computed by PubChem (NCBI)