cas: 5004-94-4 — see every product listed under this CAS number, including other names
4-Phenylpiperidin-4-ol hydrochloride, 95%, 95% (CAS 5004-94-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E1JG-250mg |
| cas | 5004-94-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 856.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-phenylpiperidin-4-ol;hydrochloride (CAS 5004-94-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 4-phenylpiperidin-4-ol;hydrochloride. InChIKey: SETKGOFWOWUIIE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 4-phenylpiperidin-4-ol;hydrochloride |
| InChIKey | SETKGOFWOWUIIE-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)