cas: 103797-19-9 — see every product listed under this CAS number, including other names
4-Tert-butyl-2-nitrobenzoic acid, 98% (CAS 103797-19-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F667218-1G |
| cas | 103797-19-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3501.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-tert-butyl-2-nitrobenzoic acid (CAS 103797-19-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 4-tert-butyl-2-nitrobenzoic acid. InChIKey: WVADEHDXGNQZNV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 4-tert-butyl-2-nitrobenzoic acid |
| InChIKey | WVADEHDXGNQZNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)