CAS 917222-23-2 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 95%, 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 95+%, 95+%, 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 98.0%, 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 98%, 2,5-Dioxopyrrolidin-1-yl hept-6-ynoate, 95+%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 250 mg, 1 g, 500 mg.
(2,5-dioxopyrrolidin-1-yl) hept-6-ynoate (CAS 917222-23-2) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) hept-6-ynoate. InChIKey: KENPLOYECFEPSG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) hept-6-ynoate |
| InChIKey | KENPLOYECFEPSG-UHFFFAOYSA-N |
| SMILES | C#CCCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)