cas: 80756-85-0 — see every product listed under this CAS number, including other names
4-Thiazoleethanethioic acid, 2-amino-α-(methoxyimino)-, S-2-benzothiazolyl ester, (αZ)-, 97%, 97% (CAS 80756-85-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 50g, 75g, 200g, 300g, 400g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CPR-5g |
| cas | 80756-85-0 |
| size | 5g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 50g | 126.80 Pln | |
| Chemat | 75g | 155.60 Pln | |
| Chemat | 200g | 266.00 Pln | |
| Chemat | 300g | 366.80 Pln | |
| Chemat | 400g | 462.80 Pln | |
| Chemat | 500g | 590.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate (CAS 80756-85-0) is a chemical compound with the molecular formula C13H10N4O2S3 and a molecular weight of 350.4 g/mol. IUPAC name: S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate. InChIKey: COFDRZLHVALCDU-YVLHZVERSA-N.
| Molecular formula | C13H10N4O2S3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | S-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate |
| InChIKey | COFDRZLHVALCDU-YVLHZVERSA-N |
| SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=O)SC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)