CAS 959246-33-4 appears in our catalog under these names: Ceftriaxone Impurity 3, Ceftriaxone Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
O-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate (CAS 959246-33-4) is a chemical compound with the molecular formula C13H10N4O2S3 and a molecular weight of 350.4 g/mol. IUPAC name: O-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate. InChIKey: WRTVTCFELAEIEQ-YVLHZVERSA-N.
| Molecular formula | C13H10N4O2S3 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | O-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate |
| InChIKey | WRTVTCFELAEIEQ-YVLHZVERSA-N |
| SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=S)OC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)