Products 84994-24-1

CAS 84994-24-1 appears in our catalog under these names: Cefmenoxime Impurity 1, Ceftriaxone Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

O-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate (CAS 84994-24-1) is a chemical compound with the molecular formula C13H10N4O2S3 and a molecular weight of 350.4 g/mol. IUPAC name: O-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate. InChIKey: WRTVTCFELAEIEQ-YVLHZVERSA-N.

Identity
Molecular formulaC13H10N4O2S3
Molecular weight350.4 g/mol
IUPAC nameO-(1,3-benzothiazol-2-yl) (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoethanethioate
InChIKeyWRTVTCFELAEIEQ-YVLHZVERSA-N
SMILESCO/N=C(/C1=CSC(=N1)N)\C(=S)OC2=NC3=CC=CC=C3S2

Computed by PubChem (NCBI)