cas: 7478-69-5 — see every product listed under this CAS number, including other names
4-Vinylidenebis(N,N-dimethylaniline) 97% (CAS 7478-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182938-250mg |
| cas | 7478-69-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1460.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A182938 |
4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline (CAS 7478-69-5) is a chemical compound with the molecular formula C18H22N2 and a molecular weight of 266.4 g/mol. IUPAC name: 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline. InChIKey: HBWITNNIJDLPLS-UHFFFAOYSA-N.
| Molecular formula | C18H22N2 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-[1-[4-(dimethylamino)phenyl]ethenyl]-N,N-dimethylaniline |
| InChIKey | HBWITNNIJDLPLS-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)