cas: 1351668-22-8 — see every product listed under this CAS number, including other names
4-bromo-7-ethoxy-2H-indazole (CAS 1351668-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632412-1G |
| cas | 1351668-22-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6651.84 Pln | |
| Fluorochem | 5g | 19808.67 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-7-ethoxy-1H-indazole (CAS 1351668-22-8) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 4-bromo-7-ethoxy-1H-indazole. InChIKey: VGLUQJYMFHLDHN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 4-bromo-7-ethoxy-1H-indazole |
| InChIKey | VGLUQJYMFHLDHN-UHFFFAOYSA-N |
| SMILES | CCOC1=C2C(=C(C=C1)Br)C=NN2 |
Computed by PubChem (NCBI)