4-cyclopropyl-2-fluoro-benzamide, 97%
cas: 2167471-91-0 — see every product listed under this CAS number, including other names
4-cyclopropyl-2-fluoro-benzamide, 97% (CAS 2167471-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW3L-100mg |
| cas | 2167471-91-0 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 500mg | 1331.60 Pln | |
| Chemat | 1g | 1826.00 Pln | |
| Chemat | 5g | 5762.00 Pln | |
| Chemat | 10g | 9558.80 Pln | |
| Fluorochem | 100mg | 1086.09 Pln | |
| Fluorochem | 250mg | 1419.31 Pln | |
| Fluorochem | 500mg | 2476.23 Pln | |
| Fluorochem | 1g | 3371.75 Pln | |
| Fluorochem | 5g | 10509.86 Pln | |
| Fluorochem | 10g | 17455.33 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-cyclopropyl-2-fluorobenzamide (CAS 2167471-91-0) is a chemical compound with the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. IUPAC name: 4-cyclopropyl-2-fluorobenzamide. InChIKey: DGIBGBWRVVUVCZ-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO |
|---|---|
| Molecular weight | 179.19 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluorobenzamide |
| InChIKey | DGIBGBWRVVUVCZ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)N)F |
Computed by PubChem (NCBI)