cas: 2060026-75-5 — see every product listed under this CAS number, including other names
4-hydroxybenzene-1-sulfonic acid dihydrate, 85%, 85% (CAS 2060026-75-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 200g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BV8J-25g |
| cas | 2060026-75-5 |
| size | 25g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 200g | 203.60 Pln | |
| Chemat | 500g | 316.80 Pln |
| purity | 85% |
|---|---|
| delivery time | 3 weeks |
4-hydroxybenzenesulfonic acid;dihydrate (CAS 2060026-75-5) is a chemical compound with the molecular formula C6H10O6S and a molecular weight of 210.21 g/mol. IUPAC name: 4-hydroxybenzenesulfonic acid;dihydrate. InChIKey: FVULJAPNZJRJMC-UHFFFAOYSA-N.
| Molecular formula | C6H10O6S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 4-hydroxybenzenesulfonic acid;dihydrate |
| InChIKey | FVULJAPNZJRJMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)S(=O)(=O)O.O.O |
Computed by PubChem (NCBI)