CAS 16002-30-5 is the registry number for Methyl 2-(2-methoxy-2-oxoethanesulfonyl)acetate, 95%. Offered by: AmBeed. Available pack sizes: 10g.
Methyl 2-(2-methoxy-2-oxoethyl)sulfonylacetate (CAS 16002-30-5) is a chemical compound with the molecular formula C6H10O6S and a molecular weight of 210.21 g/mol. IUPAC name: methyl 2-(2-methoxy-2-oxoethyl)sulfonylacetate. InChIKey: XWPWFILACZRQRM-UHFFFAOYSA-N.
| Molecular formula | C6H10O6S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | methyl 2-(2-methoxy-2-oxoethyl)sulfonylacetate |
| InChIKey | XWPWFILACZRQRM-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CC(=O)OC |
Computed by PubChem (NCBI)