CAS 1156663-75-0 is the registry number for 3-(2-Methoxy-2-oxoethanesulfonyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2-methoxy-2-oxoethyl)sulfonylpropanoic acid (CAS 1156663-75-0) is a chemical compound with the molecular formula C6H10O6S and a molecular weight of 210.21 g/mol. IUPAC name: 3-(2-methoxy-2-oxoethyl)sulfonylpropanoic acid. InChIKey: PAQDCOIWLGCJFY-UHFFFAOYSA-N.
| Molecular formula | C6H10O6S |
|---|---|
| Molecular weight | 210.21 g/mol |
| IUPAC name | 3-(2-methoxy-2-oxoethyl)sulfonylpropanoic acid |
| InChIKey | PAQDCOIWLGCJFY-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)