cas: 55843-91-9 — see every product listed under this CAS number, including other names
4-imidazo[1,2-a]pyridin-2-ylbenzonitrile, 98%, 98% (CAS 55843-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0YU-100mg |
| cas | 55843-91-9 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1288.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-imidazo[1,2-a]pyridin-2-ylbenzonitrile (CAS 55843-91-9) is a chemical compound with the molecular formula C14H9N3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-imidazo[1,2-a]pyridin-2-ylbenzonitrile. InChIKey: QKFAADBAQQYFIL-UHFFFAOYSA-N.
| Molecular formula | C14H9N3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 4-imidazo[1,2-a]pyridin-2-ylbenzonitrile |
| InChIKey | QKFAADBAQQYFIL-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)