cas: 1060810-79-8 — see every product listed under this CAS number, including other names
4-oxo-6-(trifluoromethyl)-1,4-dihydropyridine-3-carboxylic acid, 98% (CAS 1060810-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F765707-100MG |
| cas | 1060810-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1455.76 Pln | |
| Fluorochem | 500mg | 2851.10 Pln | |
| Fluorochem | 1g | 4314.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid (CAS 1060810-79-8) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 4-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid. InChIKey: QCVVDMURRBDYJA-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 4-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid |
| InChIKey | QCVVDMURRBDYJA-UHFFFAOYSA-N |
| SMILES | C1=C(NC=C(C1=O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)