cas: 76884-55-4 — see every product listed under this CAS number, including other names
4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid, ≥95%, ≥95% (CAS 76884-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NKXR-100mg |
| cas | 76884-55-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 250mg | 986.00 Pln | |
| Chemat | 1g | 2373.20 Pln | |
| Chemat | 5g | 5541.20 Pln | |
| Chemat | 10g | 8334.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid (CAS 76884-55-4) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid. InChIKey: LNRTVAGIGIAARK-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-3-carboxylic acid |
| InChIKey | LNRTVAGIGIAARK-UHFFFAOYSA-N |
| SMILES | C1CC2=NC=C(C(=O)N2C1)C(=O)O |
Computed by PubChem (NCBI)