cas: 79822-46-1 — see every product listed under this CAS number, including other names
4-tert-Butyl-3-methoxybenzoic acid, 97% (CAS 79822-46-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F065616-1G |
| cas | 79822-46-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 279.09 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 674.78 Pln | |
| Fluorochem | 100g | 2127.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-tert-butyl-3-methoxybenzoic acid (CAS 79822-46-1) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 4-tert-butyl-3-methoxybenzoic acid. InChIKey: CSJQLIMNCLFPLZ-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 4-tert-butyl-3-methoxybenzoic acid |
| InChIKey | CSJQLIMNCLFPLZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)