cas: 3883-86-1 — see every product listed under this CAS number, including other names
4H,4H'-Octafluorobiphenyl (CAS 3883-86-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010500-250MG |
| cas | 3883-86-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1028.82 Pln |
| delivery time | 3-4 weeks |
|---|
1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene (CAS 3883-86-1) is a chemical compound with the molecular formula C12H2F8 and a molecular weight of 298.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene. InChIKey: QWCHHUZAAGRHDB-UHFFFAOYSA-N.
| Molecular formula | C12H2F8 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene |
| InChIKey | QWCHHUZAAGRHDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C2=C(C(=CC(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)