Products 930478-88-9
CAS 930478-88-9 appears in our catalog under these names: 4i/ 99.49% (existing batch purity), N-(3-Chloro-2-methylphenyl)quinoxaline-2-carboxamide, 99%, 99%, 5-HT3 antagonist 4. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg.
N-(3-chloro-2-methylphenyl)quinoxaline-2-carboxamide (CAS 930478-88-9) is a chemical compound with the molecular formula C16H12ClN3O and a molecular weight of 297.74 g/mol. IUPAC name: N-(3-chloro-2-methylphenyl)quinoxaline-2-carboxamide. InChIKey: SCIBFCFFUQXLCN-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | N-(3-chloro-2-methylphenyl)quinoxaline-2-carboxamide |
| InChIKey | SCIBFCFFUQXLCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)C2=NC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)